Organic acids and derivatives
Filtered Search Results
4-Fluoro-3-(tetrazol-5-yl)phenylboronic acid, 95%, Thermo Scientific™
CAS: 1009303-56-3 Molecular Formula: C7H6BFN4O2 Molecular Weight (g/mol): 207.96 MDL Number: MFCD13176533 InChI Key: FELFJHZMQYCKPT-UHFFFAOYSA-N Synonym: 4-fluoro-3-tetrazol-5-yl phenylboronic acid,4-fluoro-3-1h-1,2,3,4-tetrazol-5-yl phenylboronic acid,4-fluoro-3-1h-tetrazol-5-yl phenyl boronic acid,4-fluoro-3-1h-tetrazol-5-yl phenylboronic acid PubChem CID: 11287236 IUPAC Name: [4-fluoro-3-(2H-tetrazol-5-yl)phenyl]boronic acid SMILES: OB(O)C1=CC(C2=NNN=N2)=C(F)C=C1
| PubChem CID | 11287236 |
|---|---|
| CAS | 1009303-56-3 |
| Molecular Weight (g/mol) | 207.96 |
| MDL Number | MFCD13176533 |
| SMILES | OB(O)C1=CC(C2=NNN=N2)=C(F)C=C1 |
| Synonym | 4-fluoro-3-tetrazol-5-yl phenylboronic acid,4-fluoro-3-1h-1,2,3,4-tetrazol-5-yl phenylboronic acid,4-fluoro-3-1h-tetrazol-5-yl phenyl boronic acid,4-fluoro-3-1h-tetrazol-5-yl phenylboronic acid |
| IUPAC Name | [4-fluoro-3-(2H-tetrazol-5-yl)phenyl]boronic acid |
| InChI Key | FELFJHZMQYCKPT-UHFFFAOYSA-N |
| Molecular Formula | C7H6BFN4O2 |
4-(Tetrazol-5-yl)phenylboronic acid, 97%
CAS: 179942-55-3 Molecular Formula: C7H7BN4O2 Molecular Weight (g/mol): 189.97 MDL Number: MFCD06739099 MFCD11044435 InChI Key: DXUPJOQUAAVAGV-UHFFFAOYSA-N Synonym: 4-2h-tetrazol-5-yl phenyl boronic acid,4-2h-tetrazol-5-yl phenylboronic acid,4-tetrazol-5-yl phenylboronic acid,4-2h-tetrazol-5-yl-phenylboronic acid,4-1h-tetrazol-5-yl-phenylboronic acid,4-2h-1,2,3,4-tetrazol-5-yl phenyl boronic acid,4-1h-1,2,3,4-tetrazol-5-yl phenylboronic acid,4-2h-1,2,3,4-tetrazol-5-yl phenylboronic acid,4-1htetrazol-5-yl phenylboronic acid PubChem CID: 46737995 IUPAC Name: [4-(2H-tetrazol-5-yl)phenyl]boronic acid SMILES: OB(O)C1=CC=C(C=C1)C1=NNN=N1
| PubChem CID | 46737995 |
|---|---|
| CAS | 179942-55-3 |
| Molecular Weight (g/mol) | 189.97 |
| MDL Number | MFCD06739099 MFCD11044435 |
| SMILES | OB(O)C1=CC=C(C=C1)C1=NNN=N1 |
| Synonym | 4-2h-tetrazol-5-yl phenyl boronic acid,4-2h-tetrazol-5-yl phenylboronic acid,4-tetrazol-5-yl phenylboronic acid,4-2h-tetrazol-5-yl-phenylboronic acid,4-1h-tetrazol-5-yl-phenylboronic acid,4-2h-1,2,3,4-tetrazol-5-yl phenyl boronic acid,4-1h-1,2,3,4-tetrazol-5-yl phenylboronic acid,4-2h-1,2,3,4-tetrazol-5-yl phenylboronic acid,4-1htetrazol-5-yl phenylboronic acid |
| IUPAC Name | [4-(2H-tetrazol-5-yl)phenyl]boronic acid |
| InChI Key | DXUPJOQUAAVAGV-UHFFFAOYSA-N |
| Molecular Formula | C7H7BN4O2 |
Methyl 3-cyclohexenecarboxylate, 97%, Thermo Scientific™
CAS: 6493-77-2 Molecular Formula: C8H12O2 Molecular Weight (g/mol): 140.18 MDL Number: MFCD00053266 InChI Key: IPUNVLFESXFVFH-UHFFFAOYNA-N Synonym: methyl cyclohex-3-enecarboxylate,3-cyclohexene-1-carboxylic acid methyl ester,methyl 3-cyclohexenecarboxylate,3-cyclohexene-1-carboxylic acid, methyl ester,methyl 3-cyclohexene-1-carboxylate,1-carbomethoxy-3-cyclohexene,methyl 4-cyclohexenecarboxylate,methyl 1,2,3,6-tetrahydrobenzoate,1,3-butadiene-methyl acrylate adduct,acmc-1bity PubChem CID: 96926 IUPAC Name: methyl cyclohex-3-ene-1-carboxylate SMILES: COC(=O)C1CCC=CC1
| PubChem CID | 96926 |
|---|---|
| CAS | 6493-77-2 |
| Molecular Weight (g/mol) | 140.18 |
| MDL Number | MFCD00053266 |
| SMILES | COC(=O)C1CCC=CC1 |
| Synonym | methyl cyclohex-3-enecarboxylate,3-cyclohexene-1-carboxylic acid methyl ester,methyl 3-cyclohexenecarboxylate,3-cyclohexene-1-carboxylic acid, methyl ester,methyl 3-cyclohexene-1-carboxylate,1-carbomethoxy-3-cyclohexene,methyl 4-cyclohexenecarboxylate,methyl 1,2,3,6-tetrahydrobenzoate,1,3-butadiene-methyl acrylate adduct,acmc-1bity |
| IUPAC Name | methyl cyclohex-3-ene-1-carboxylate |
| InChI Key | IPUNVLFESXFVFH-UHFFFAOYNA-N |
| Molecular Formula | C8H12O2 |
Methylboronic acid, 97%
CAS: 13061-96-6 Molecular Formula: CH5BO2 Molecular Weight (g/mol): 59.86 MDL Number: MFCD00002105 InChI Key: KTMKRRPZPWUYKK-UHFFFAOYSA-N Synonym: methaneboronic acid,methyl boronic acid,dihydroxymethylborane,boronic acid, methyl,unii-8z1me41sch,methane boronic acid,8z1me41sch,methylboronicacid,methyboronic acid,methyl-boronic acid PubChem CID: 139377 IUPAC Name: methylboronic acid SMILES: CB(O)O
| PubChem CID | 139377 |
|---|---|
| CAS | 13061-96-6 |
| Molecular Weight (g/mol) | 59.86 |
| MDL Number | MFCD00002105 |
| SMILES | CB(O)O |
| Synonym | methaneboronic acid,methyl boronic acid,dihydroxymethylborane,boronic acid, methyl,unii-8z1me41sch,methane boronic acid,8z1me41sch,methylboronicacid,methyboronic acid,methyl-boronic acid |
| IUPAC Name | methylboronic acid |
| InChI Key | KTMKRRPZPWUYKK-UHFFFAOYSA-N |
| Molecular Formula | CH5BO2 |
Tamoxifen Citrate, USP, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 54965-24-1 Molecular Formula: C32H37NO8 Molecular Weight (g/mol): 563.65 MDL Number: MFCD00058321 InChI Key: FQZYTYWMLGAPFJ-OQKDUQJOSA-N IUPAC Name: (2-{4-[(1Z)-1,2-diphenylbut-1-en-1-yl]phenoxy}ethyl)dimethylamine; 2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O.CC\C(=C(/C1=CC=CC=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1
| CAS | 54965-24-1 |
|---|---|
| Molecular Weight (g/mol) | 563.65 |
| MDL Number | MFCD00058321 |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O.CC\C(=C(/C1=CC=CC=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1 |
| IUPAC Name | (2-{4-[(1Z)-1,2-diphenylbut-1-en-1-yl]phenoxy}ethyl)dimethylamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | FQZYTYWMLGAPFJ-OQKDUQJOSA-N |
| Molecular Formula | C32H37NO8 |
1-Hydroxyethylidenebis(phosphonic acid), 96%
CAS: 2809-21-4 Molecular Formula: C2H8O7P2 Molecular Weight (g/mol): 206.027 MDL Number: MFCD00070585 InChI Key: DBVJJBKOTRCVKF-UHFFFAOYSA-N Synonym: etidronic acid,etidronate,hedp,1-hydroxyethylidene-1,1-diphosphonic acid,ehdp,etidronsaeure,acetodiphosphonic acid,hydroxyethanediphosphonic acid,oxyethylidenediphosphonic acid,turpinal sl PubChem CID: 3305 ChEBI: CHEBI:4907 IUPAC Name: (1-hydroxy-1-phosphonoethyl)phosphonic acid SMILES: CC(O)(P(=O)(O)O)P(=O)(O)O
| PubChem CID | 3305 |
|---|---|
| CAS | 2809-21-4 |
| Molecular Weight (g/mol) | 206.027 |
| ChEBI | CHEBI:4907 |
| MDL Number | MFCD00070585 |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O |
| Synonym | etidronic acid,etidronate,hedp,1-hydroxyethylidene-1,1-diphosphonic acid,ehdp,etidronsaeure,acetodiphosphonic acid,hydroxyethanediphosphonic acid,oxyethylidenediphosphonic acid,turpinal sl |
| IUPAC Name | (1-hydroxy-1-phosphonoethyl)phosphonic acid |
| InChI Key | DBVJJBKOTRCVKF-UHFFFAOYSA-N |
| Molecular Formula | C2H8O7P2 |
Trifluoromethanesulfonic anhydride, 98%
CAS: 358-23-6 Molecular Formula: C2F6O5S2 Molecular Weight (g/mol): 282.127 MDL Number: MFCD00000408 InChI Key: WJKHJLXJJJATHN-UHFFFAOYSA-N Synonym: trifluoromethanesulfonic anhydride,triflic anhydride,trifluoromethanesulphonic anhydride,trifluoromethanesulfonic acid anhydride,methanesulfonic acid, trifluoro-, anhydride,trifluoromethanesulphonic acid anhydride,unii-8w034lhg1u,tf2o,trifluoromethane sulfonyl trifluoromethanesulfonate,trifluoromethane sulfonic anhydride PubChem CID: 67749 ChEBI: CHEBI:48509 IUPAC Name: trifluoromethylsulfonyl trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F
| PubChem CID | 67749 |
|---|---|
| CAS | 358-23-6 |
| Molecular Weight (g/mol) | 282.127 |
| ChEBI | CHEBI:48509 |
| MDL Number | MFCD00000408 |
| SMILES | C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F |
| Synonym | trifluoromethanesulfonic anhydride,triflic anhydride,trifluoromethanesulphonic anhydride,trifluoromethanesulfonic acid anhydride,methanesulfonic acid, trifluoro-, anhydride,trifluoromethanesulphonic acid anhydride,unii-8w034lhg1u,tf2o,trifluoromethane sulfonyl trifluoromethanesulfonate,trifluoromethane sulfonic anhydride |
| IUPAC Name | trifluoromethylsulfonyl trifluoromethanesulfonate |
| InChI Key | WJKHJLXJJJATHN-UHFFFAOYSA-N |
| Molecular Formula | C2F6O5S2 |
Phosphonoacetic acid, 98+%
CAS: 4408-78-0 Molecular Formula: C2H5O5P Molecular Weight (g/mol): 140.03 MDL Number: MFCD00004311 InChI Key: XUYJLQHKOGNDPB-UHFFFAOYSA-N Synonym: phosphonoacetic acid,fosfonet,phosphonoacetate,acetic acid, phosphono,fosfonet sodium,phosphonacetic acid,carboxymethanephosphonic acid,fosfonoacetic acid,disodium phosphonoacetate,lopac-p-6909 PubChem CID: 546 ChEBI: CHEBI:15732 IUPAC Name: 2-phosphonoacetic acid SMILES: OC(=O)CP(O)(O)=O
| PubChem CID | 546 |
|---|---|
| CAS | 4408-78-0 |
| Molecular Weight (g/mol) | 140.03 |
| ChEBI | CHEBI:15732 |
| MDL Number | MFCD00004311 |
| SMILES | OC(=O)CP(O)(O)=O |
| Synonym | phosphonoacetic acid,fosfonet,phosphonoacetate,acetic acid, phosphono,fosfonet sodium,phosphonacetic acid,carboxymethanephosphonic acid,fosfonoacetic acid,disodium phosphonoacetate,lopac-p-6909 |
| IUPAC Name | 2-phosphonoacetic acid |
| InChI Key | XUYJLQHKOGNDPB-UHFFFAOYSA-N |
| Molecular Formula | C2H5O5P |
Ethyl tetradecanoate, 98%
CAS: 124-06-1 Molecular Formula: C16H32O2 Molecular Weight (g/mol): 256.43 MDL Number: MFCD00008984 InChI Key: MMKRHZKQPFCLLS-UHFFFAOYSA-N Synonym: ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid PubChem CID: 31283 ChEBI: CHEBI:84849 IUPAC Name: ethyl tetradecanoate SMILES: CCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 31283 |
|---|---|
| CAS | 124-06-1 |
| Molecular Weight (g/mol) | 256.43 |
| ChEBI | CHEBI:84849 |
| MDL Number | MFCD00008984 |
| SMILES | CCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid |
| IUPAC Name | ethyl tetradecanoate |
| InChI Key | MMKRHZKQPFCLLS-UHFFFAOYSA-N |
| Molecular Formula | C16H32O2 |
Propargyl acrylate, 96%, stab. with ca 200ppm BHT
CAS: 10477-47-1 Molecular Formula: C6H6O2 Molecular Weight (g/mol): 110.11 MDL Number: MFCD00078451 InChI Key: WPBNLDNIZUGLJL-UHFFFAOYSA-N Synonym: propargyl acrylate,2-propenoic acid, 2-propynyl ester,acrylic acid propargyl ester,2-propenoic acid, 2-propyn-1-yl ester,2-propynyl acrylate,prop-2-yn-1-yl acrylate,acmc-1c257,prop-2-yn-1-yl prop-2-enoate,propargyl acrylate, PubChem CID: 82655 SMILES: C=CC(=O)OCC#C
| PubChem CID | 82655 |
|---|---|
| CAS | 10477-47-1 |
| Molecular Weight (g/mol) | 110.11 |
| MDL Number | MFCD00078451 |
| SMILES | C=CC(=O)OCC#C |
| Synonym | propargyl acrylate,2-propenoic acid, 2-propynyl ester,acrylic acid propargyl ester,2-propenoic acid, 2-propyn-1-yl ester,2-propynyl acrylate,prop-2-yn-1-yl acrylate,acmc-1c257,prop-2-yn-1-yl prop-2-enoate,propargyl acrylate, |
| InChI Key | WPBNLDNIZUGLJL-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2 |
Cyclohexanecarboxylic acid, 98%
CAS: 98-89-5 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.171 MDL Number: MFCD00001461 InChI Key: NZNMSOFKMUBTKW-UHFFFAOYSA-N Synonym: hexahydrobenzoic acid,carboxycyclohexane,cyclohexanoic acid,cyclohexylcarboxylic acid,cyclohexylmethanoic acid,cyclohexylformic acid,benzoic acid, hexahydro,cyclohexancarbonsaeure,cyclohexane-1-carboxylate,cyclohexanecarboxylicacid PubChem CID: 7413 ChEBI: CHEBI:36096 IUPAC Name: cyclohexanecarboxylic acid SMILES: C1CCC(CC1)C(=O)O
| PubChem CID | 7413 |
|---|---|
| CAS | 98-89-5 |
| Molecular Weight (g/mol) | 128.171 |
| ChEBI | CHEBI:36096 |
| MDL Number | MFCD00001461 |
| SMILES | C1CCC(CC1)C(=O)O |
| Synonym | hexahydrobenzoic acid,carboxycyclohexane,cyclohexanoic acid,cyclohexylcarboxylic acid,cyclohexylmethanoic acid,cyclohexylformic acid,benzoic acid, hexahydro,cyclohexancarbonsaeure,cyclohexane-1-carboxylate,cyclohexanecarboxylicacid |
| IUPAC Name | cyclohexanecarboxylic acid |
| InChI Key | NZNMSOFKMUBTKW-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
Phthalimidoacetaldehyde diethyl acetal, 99%
CAS: 78902-09-7 Molecular Formula: C14H17NO4 Molecular Weight (g/mol): 263.29 MDL Number: MFCD00005901 InChI Key: GEFXJJJQUSEHLV-UHFFFAOYSA-N Synonym: phthalimidoacetaldehyde diethyl acetal,2-2,2-diethoxyethyl isoindoline-1,3-dione,n-2,2-diethoxyethyl phthalimide,2-phthalimidoacetaldehyde diethyl acetal,2-phthalimido acetaldehyde diethylacetal,2-2,2-diethoxyethyl isoindole-1,3-dione,1h-isoindole-1,3 2h-dione, 2-2,2-diethoxyethyl,2-2,2-diethoxyethyl-1h-isoindole-1,3 2h-dione,2-2,2-diethoxyethyl benzo c azoline-1,3-dione,acmc-209pfw PubChem CID: 315286 IUPAC Name: 2-(2,2-diethoxyethyl)isoindole-1,3-dione SMILES: CCOC(CN1C(=O)C2=CC=CC=C2C1=O)OCC
| PubChem CID | 315286 |
|---|---|
| CAS | 78902-09-7 |
| Molecular Weight (g/mol) | 263.29 |
| MDL Number | MFCD00005901 |
| SMILES | CCOC(CN1C(=O)C2=CC=CC=C2C1=O)OCC |
| Synonym | phthalimidoacetaldehyde diethyl acetal,2-2,2-diethoxyethyl isoindoline-1,3-dione,n-2,2-diethoxyethyl phthalimide,2-phthalimidoacetaldehyde diethyl acetal,2-phthalimido acetaldehyde diethylacetal,2-2,2-diethoxyethyl isoindole-1,3-dione,1h-isoindole-1,3 2h-dione, 2-2,2-diethoxyethyl,2-2,2-diethoxyethyl-1h-isoindole-1,3 2h-dione,2-2,2-diethoxyethyl benzo c azoline-1,3-dione,acmc-209pfw |
| IUPAC Name | 2-(2,2-diethoxyethyl)isoindole-1,3-dione |
| InChI Key | GEFXJJJQUSEHLV-UHFFFAOYSA-N |
| Molecular Formula | C14H17NO4 |
Methyl 4-bromo-3-hydroxythiophene-2-carboxylate, 97%
CAS: 95201-93-7 Molecular Formula: C6H5BrO3S Molecular Weight (g/mol): 237.067 MDL Number: MFCD00052081 InChI Key: UFTXASQYKJFRKI-UHFFFAOYSA-N Synonym: 2z-4-bromo-2-hydroxy methoxy methylidene thiophen-3-one,2-thiophenecarboxylic acid, 4-bromo-3-hydroxy-, methyl ester,acmc-20akgk,maybridge1_004012,methyl 4-bromo-3-hydroxy-2-thiophenecarboxylate,methyl-3-hydroxy-4-bromo-2-thiophenecarboxylate,methyl-4-bromo-3-hydroxy-2-thiophenecarboxylate,4-bromo-3-oxo-2-thienylidene-methoxy-methanolate,4-bromo-2-hydroxy methoxy methylidene thiophen-3-one,2-thiophenecarboxylicacid,4-bromo-3-hydroxy-,methyl ester PubChem CID: 2777611 IUPAC Name: methyl 4-bromo-3-hydroxythiophene-2-carboxylate SMILES: COC(=O)C1=C(C(=CS1)Br)O
| PubChem CID | 2777611 |
|---|---|
| CAS | 95201-93-7 |
| Molecular Weight (g/mol) | 237.067 |
| MDL Number | MFCD00052081 |
| SMILES | COC(=O)C1=C(C(=CS1)Br)O |
| Synonym | 2z-4-bromo-2-hydroxy methoxy methylidene thiophen-3-one,2-thiophenecarboxylic acid, 4-bromo-3-hydroxy-, methyl ester,acmc-20akgk,maybridge1_004012,methyl 4-bromo-3-hydroxy-2-thiophenecarboxylate,methyl-3-hydroxy-4-bromo-2-thiophenecarboxylate,methyl-4-bromo-3-hydroxy-2-thiophenecarboxylate,4-bromo-3-oxo-2-thienylidene-methoxy-methanolate,4-bromo-2-hydroxy methoxy methylidene thiophen-3-one,2-thiophenecarboxylicacid,4-bromo-3-hydroxy-,methyl ester |
| IUPAC Name | methyl 4-bromo-3-hydroxythiophene-2-carboxylate |
| InChI Key | UFTXASQYKJFRKI-UHFFFAOYSA-N |
| Molecular Formula | C6H5BrO3S |
2-Ethylhexanoic acid, 99%
CAS: 149-57-5 Molecular Formula: C8H16O2 Molecular Weight (g/mol): 144.214 MDL Number: MFCD00002675 InChI Key: OBETXYAYXDNJHR-UHFFFAOYSA-N Synonym: 2-ethylcaproic acid,hexanoic acid, 2-ethyl,ethylhexanoic acid,ethylhexoic acid,2-ethylhexoic acid,butylethylacetic acid,2-butylbutanoic acid,3-heptanecarboxylic acid,ethyl hexanoic acid,2-ethyl-hexoic acid PubChem CID: 8697 IUPAC Name: 2-ethylhexanoic acid SMILES: CCCCC(CC)C(=O)O
| PubChem CID | 8697 |
|---|---|
| CAS | 149-57-5 |
| Molecular Weight (g/mol) | 144.214 |
| MDL Number | MFCD00002675 |
| SMILES | CCCCC(CC)C(=O)O |
| Synonym | 2-ethylcaproic acid,hexanoic acid, 2-ethyl,ethylhexanoic acid,ethylhexoic acid,2-ethylhexoic acid,butylethylacetic acid,2-butylbutanoic acid,3-heptanecarboxylic acid,ethyl hexanoic acid,2-ethyl-hexoic acid |
| IUPAC Name | 2-ethylhexanoic acid |
| InChI Key | OBETXYAYXDNJHR-UHFFFAOYSA-N |
| Molecular Formula | C8H16O2 |
Sodium 4-hydroxybenzenesulfonate dihydrate, 97%
CAS: 10580-19-5 Molecular Formula: C6H5O4S Molecular Weight (g/mol): 173.16 MDL Number: MFCD00044734,MFCD00150724 InChI Key: FEPBITJSIHRMRT-UHFFFAOYSA-M Synonym: sodium 4-hydroxybenzenesulfonate dihydrate,unii-5nh81n759q,phenol-4-sulfonic acid sodium salt dihydrate,4-hydroxybenzenesulfonic acid sodium salt dihydrate,benzenesulfonic acid, 4-hydroxy-, monosodium salt, dihydrate,4-hydroxybenzenesulfonic acid sodium salt,sodium 4-hydroxybenzene-1-sulfonate dihydrate,phenolsulphonate sodium usp,acmc-2098hs,sodium p-phenolsulfonate dihydrate PubChem CID: 23666329 IUPAC Name: sodium;4-hydroxybenzenesulfonate;dihydrate SMILES: OC1=CC=C(C=C1)S([O-])(=O)=O
| PubChem CID | 23666329 |
|---|---|
| CAS | 10580-19-5 |
| Molecular Weight (g/mol) | 173.16 |
| MDL Number | MFCD00044734,MFCD00150724 |
| SMILES | OC1=CC=C(C=C1)S([O-])(=O)=O |
| Synonym | sodium 4-hydroxybenzenesulfonate dihydrate,unii-5nh81n759q,phenol-4-sulfonic acid sodium salt dihydrate,4-hydroxybenzenesulfonic acid sodium salt dihydrate,benzenesulfonic acid, 4-hydroxy-, monosodium salt, dihydrate,4-hydroxybenzenesulfonic acid sodium salt,sodium 4-hydroxybenzene-1-sulfonate dihydrate,phenolsulphonate sodium usp,acmc-2098hs,sodium p-phenolsulfonate dihydrate |
| IUPAC Name | sodium;4-hydroxybenzenesulfonate;dihydrate |
| InChI Key | FEPBITJSIHRMRT-UHFFFAOYSA-M |
| Molecular Formula | C6H5O4S |